C22H18BrNO5 — CID 18879753
7-bromo-1-(3-methoxy-4-prop-2-enoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18879753) has the molecular formula C22H18BrNO5 and a molecular weight of 456.29 g/mol. Its IUPAC name is 7-bromo-1-(3-methoxy-4-prop-2-enoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-methoxy-4-prop-2-enoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18879753 |
| Molecular Formula | C22H18BrNO5 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 7-bromo-1-(3-methoxy-4-prop-2-enoxyphenyl)-2-methyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2C)cc1OC |
| InChI | InChI=1S/C22H18BrNO5/c1-4-9-28-16-7-5-12(10-17(16)27-3)19-18-20(25)14-11-13(23)6-8-15(14)29-21(18)22(26)24(19)2/h4-8,10-11,19H,1,9H2,2-3H3 |
| InChIKey | TVXYDPATOSJHKR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|