C21H16BrNO5 — CID 19130613
7-bromo-1-(3-methoxy-4-prop-2-enoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19130613) has the molecular formula C21H16BrNO5 and a molecular weight of 442.27 g/mol. Its IUPAC name is 7-bromo-1-(3-methoxy-4-prop-2-enoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-methoxy-4-prop-2-enoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19130613 |
| Molecular Formula | C21H16BrNO5 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 7-bromo-1-(3-methoxy-4-prop-2-enoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2NC(=O)c3oc4ccc(Br)cc4c(=O)c32)cc1OC |
| InChI | InChI=1S/C21H16BrNO5/c1-3-8-27-15-6-4-11(9-16(15)26-2)18-17-19(24)13-10-12(22)5-7-14(13)28-20(17)21(25)23-18/h3-7,9-10,18H,1,8H2,2H3,(H,23,25) |
| InChIKey | ZVBOFMVDOCXAGY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|