C23H21NO5 — CID 19130873
1-(3-methoxy-4-prop-2-enoxyphenyl)-5,7-dimethyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19130873) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-(3-methoxy-4-prop-2-enoxyphenyl)-5,7-dimethyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-methoxy-4-prop-2-enoxyphenyl)-5,7-dimethyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19130873 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-(3-methoxy-4-prop-2-enoxyphenyl)-5,7-dimethyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2NC(=O)c3oc4c(C)cc(C)cc4c(=O)c32)cc1OC |
| InChI | InChI=1S/C23H21NO5/c1-5-8-28-16-7-6-14(11-17(16)27-4)19-18-20(25)15-10-12(2)9-13(3)21(15)29-22(18)23(26)24-19/h5-7,9-11,19H,1,8H2,2-4H3,(H,24,26) |
| InChIKey | XNELVQBOERIEFN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|