C22H19NO4 — CID 19130805
5,6-dimethyl-1-(3-prop-2-enoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19130805) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 5,6-dimethyl-1-(3-prop-2-enoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 5,6-dimethyl-1-(3-prop-2-enoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19130805 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 5,6-dimethyl-1-(3-prop-2-enoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1cccc(C2NC(=O)c3oc4c(C)c(C)ccc4c(=O)c32)c1 |
| InChI | InChI=1S/C22H19NO4/c1-4-10-26-15-7-5-6-14(11-15)18-17-19(24)16-9-8-12(2)13(3)20(16)27-21(17)22(25)23-18/h4-9,11,18H,1,10H2,2-3H3,(H,23,25) |
| InChIKey | VJFSQUHNWOQUEM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|