C24H25NO4 — CID 19130861
5,7-dimethyl-1-(3-pentoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19130861) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 5,7-dimethyl-1-(3-pentoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 5,7-dimethyl-1-(3-pentoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19130861 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 5,7-dimethyl-1-(3-pentoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1cccc(C2NC(=O)c3oc4c(C)cc(C)cc4c(=O)c32)c1 |
| InChI | InChI=1S/C24H25NO4/c1-4-5-6-10-28-17-9-7-8-16(13-17)20-19-21(26)18-12-14(2)11-15(3)22(18)29-23(19)24(27)25-20/h7-9,11-13,20H,4-6,10H2,1-3H3,(H,25,27) |
| InChIKey | MEBRJFGYPWWVFR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|