C24H24ClNO5 — CID 19130513
7-chloro-1-(4-hexoxy-3-methoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19130513) has the molecular formula C24H24ClNO5 and a molecular weight of 441.91 g/mol. Its IUPAC name is 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19130513 |
| Molecular Formula | C24H24ClNO5 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 7-chloro-1-(4-hexoxy-3-methoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2NC(=O)c3oc4ccc(Cl)cc4c(=O)c32)cc1OC |
| InChI | InChI=1S/C24H24ClNO5/c1-3-4-5-6-11-30-18-9-7-14(12-19(18)29-2)21-20-22(27)16-13-15(25)8-10-17(16)31-23(20)24(28)26-21/h7-10,12-13,21H,3-6,11H2,1-2H3,(H,26,28) |
| InChIKey | ZDRHSFWQBJJMHW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|