C30H29FN2O5 — CID 18820883
1-(3-ethoxy-4-pentoxyphenyl)-7-fluoro-2-(6-methyl-2-pyridinyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18820883) has the molecular formula C30H29FN2O5 and a molecular weight of 516.57 g/mol. Its IUPAC name is 1-(3-ethoxy-4-pentoxyphenyl)-7-fluoro-2-(6-methyl-2-pyridinyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-ethoxy-4-pentoxyphenyl)-7-fluoro-2-(6-methyl-2-pyridinyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18820883 |
| Molecular Formula | C30H29FN2O5 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 1-(3-ethoxy-4-pentoxyphenyl)-7-fluoro-2-(6-methyl-2-pyridinyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(F)cc4c3=O)C(=O)N2c2cccc(C)n2)cc1OCC |
| InChI | InChI=1S/C30H29FN2O5/c1-4-6-7-15-37-23-13-11-19(16-24(23)36-5-2)27-26-28(34)21-17-20(31)12-14-22(21)38-29(26)30(35)33(27)25-10-8-9-18(3)32-25/h8-14,16-17,27H,4-7,15H2,1-3H3 |
| InChIKey | BPVWPTNSMVKIHF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|