C29H30FN7O2S2 — CID 18821768
N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-imino-7-octyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18821768) has the molecular formula C29H30FN7O2S2 and a molecular weight of 591.74 g/mol. Its IUPAC name is N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-imino-7-octyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-imino-7-octyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18821768 |
| Molecular Formula | C29H30FN7O2S2 |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-imino-7-octyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)Nc2nnc(SCc3ccccc3F)s2)cc2c(=O)n3ccccc3nc2n1CCCCCCCC |
| InChI | InChI=1S/C29H30FN7O2S2/c1-2-3-4-5-6-10-16-37-24(31)20(17-21-25(37)32-23-14-9-11-15-36(23)27(21)39)26(38)33-28-34-35-29(41-28)40-18-19-12-7-8-13-22(19)30/h7-9,11-15,17,31H,2-6,10,16,18H2,1H3,(H,33,34,38)/b31-24+ |
| InChIKey | WYGPQOMLQJNHMT-QFMPWRQOSA-N |
| XLogP | 6.02 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|