C26H23N7O2S2 — CID 18821786
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-cyclopentyl-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18821786) has the molecular formula C26H23N7O2S2 and a molecular weight of 529.65 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-cyclopentyl-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-cyclopentyl-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18821786 |
| Molecular Formula | C26H23N7O2S2 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-cyclopentyl-6-imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)Nc2nnc(SCc3ccccc3)s2)cc2c(=O)n3ccccc3nc2n1C1CCCC1 |
| InChI | InChI=1S/C26H23N7O2S2/c27-21-18(23(34)29-25-30-31-26(37-25)36-15-16-8-2-1-3-9-16)14-19-22(33(21)17-10-4-5-11-17)28-20-12-6-7-13-32(20)24(19)35/h1-3,6-9,12-14,17,27H,4-5,10-11,15H2,(H,29,30,34)/b27-21+ |
| InChIKey | VSADNAHXVOOTBZ-SZXQPVLSSA-N |
| XLogP | 4.64 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|