C27H21N7O3S2 — CID 18821990
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-(furan-2-ylmethyl)-6-imino-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18821990) has the molecular formula C27H21N7O3S2 and a molecular weight of 555.65 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-(furan-2-ylmethyl)-6-imino-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-(furan-2-ylmethyl)-6-imino-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18821990 |
| Molecular Formula | C27H21N7O3S2 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-(furan-2-ylmethyl)-6-imino-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)Nc2nnc(SCc3ccccc3)s2)cc2c(=O)n3cccc(C)c3nc2n1Cc1ccco1 |
| InChI | InChI=1S/C27H21N7O3S2/c1-16-7-5-11-33-22(16)29-23-20(25(33)36)13-19(21(28)34(23)14-18-10-6-12-37-18)24(35)30-26-31-32-27(39-26)38-15-17-8-3-2-4-9-17/h2-13,28H,14-15H2,1H3,(H,30,31,35)/b28-21+ |
| InChIKey | WFOZAGKNENTDBA-SGWCAAJKSA-N |
| XLogP | 4.47 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|