C25H22ClN7O3S2 — CID 18822101
N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-imino-7-(2-methoxyethyl)-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18822101) has the molecular formula C25H22ClN7O3S2 and a molecular weight of 568.08 g/mol. Its IUPAC name is N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-imino-7-(2-methoxyethyl)-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-imino-7-(2-methoxyethyl)-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18822101 |
| Molecular Formula | C25H22ClN7O3S2 |
| Molecular Weight | 568.08 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-imino-7-(2-methoxyethyl)-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)Nc2nnc(SCc3ccccc3Cl)s2)cc2c(=O)n3cccc(C)c3nc2n1CCOC |
| InChI | InChI=1S/C25H22ClN7O3S2/c1-14-6-5-9-33-20(14)28-21-17(23(33)35)12-16(19(27)32(21)10-11-36-2)22(34)29-24-30-31-25(38-24)37-13-15-7-3-4-8-18(15)26/h3-9,12,27H,10-11,13H2,1-2H3,(H,29,30,34)/b27-19+ |
| InChIKey | PGVXCNBNWHYNRP-ZXVVBBHZSA-N |
| XLogP | 4.13 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.08 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|