C22H22N6O3 — CID 18822067
7-cyclopentyl-6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18822067) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 7-cyclopentyl-6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 7-cyclopentyl-6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18822067 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 7-cyclopentyl-6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)Nc2cc(C)on2)cc2c(=O)n3cccc(C)c3nc2n1C1CCCC1 |
| InChI | InChI=1S/C22H22N6O3/c1-12-6-5-9-27-19(12)25-20-16(22(27)30)11-15(18(23)28(20)14-7-3-4-8-14)21(29)24-17-10-13(2)31-26-17/h5-6,9-11,14,23H,3-4,7-8H2,1-2H3,(H,24,26,29)/b23-18+ |
| InChIKey | JXGDUOASZPNELY-PTGBLXJZSA-N |
| XLogP | 3.10 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|