C22H24N6O3 — CID 18822037
6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18822037) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18822037 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)Nc2cc(C)on2)cc2c(=O)n3cccc(C)c3nc2n1CCCCC |
| InChI | InChI=1S/C22H24N6O3/c1-4-5-6-9-27-18(23)15(21(29)24-17-11-14(3)31-26-17)12-16-20(27)25-19-13(2)8-7-10-28(19)22(16)30/h7-8,10-12,23H,4-6,9H2,1-3H3,(H,24,26,29)/b23-18+ |
| InChIKey | XZJRYGCCHOCBLM-PTGBLXJZSA-N |
| XLogP | 3.18 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|