C27H26N6O5 — CID 18822157
7-[2-(3,4-dimethoxyphenyl)ethyl]-6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 18822157) has the molecular formula C27H26N6O5 and a molecular weight of 514.54 g/mol. Its IUPAC name is 7-[2-(3,4-dimethoxyphenyl)ethyl]-6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 7-[2-(3,4-dimethoxyphenyl)ethyl]-6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 18822157 |
| Molecular Formula | C27H26N6O5 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 7-[2-(3,4-dimethoxyphenyl)ethyl]-6-imino-11-methyl-N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)Nc2cc(C)on2)cc2c(=O)n3cccc(C)c3nc2n1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H26N6O5/c1-15-6-5-10-33-24(15)30-25-19(27(33)35)14-18(26(34)29-22-12-16(2)38-31-22)23(28)32(25)11-9-17-7-8-20(36-3)21(13-17)37-4/h5-8,10,12-14,28H,9,11H2,1-4H3,(H,29,31,34)/b28-23+ |
| InChIKey | PCDCKIIMYBKYID-WEMUOSSPSA-N |
| XLogP | 3.25 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|