C27H27FN4O — CID 18827431
1-[4-(2-fluorophenyl)piperazin-1-yl]-4-(2-pyridin-2-yl-1H-indol-3-yl)butan-1-one (PubChem CID 18827431) has the molecular formula C27H27FN4O and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-4-(2-pyridin-2-yl-1H-indol-3-yl)butan-1-one.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-4-(2-pyridin-2-yl-1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 18827431 |
| Molecular Formula | C27H27FN4O |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-4-(2-pyridin-2-yl-1H-indol-3-yl)butan-1-one |
| SMILES | O=C(CCCc1c(-c2ccccn2)[nH]c2ccccc12)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H27FN4O/c28-22-10-2-4-13-25(22)31-16-18-32(19-17-31)26(33)14-7-9-21-20-8-1-3-11-23(20)30-27(21)24-12-5-6-15-29-24/h1-6,8,10-13,15,30H,7,9,14,16-19H2 |
| InChIKey | UTYUSQAWKHVFSS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|