C25H22FN3O — CID 18833118
1-(2,3-dihydroindol-1-yl)-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butan-1-one (PubChem CID 18833118) has the molecular formula C25H22FN3O and a molecular weight of 399.47 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 18833118 |
| Molecular Formula | C25H22FN3O |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-4-(5-fluoro-2-pyridin-2-yl-1H-indol-3-yl)butan-1-one |
| SMILES | O=C(CCCc1c(-c2ccccn2)[nH]c2ccc(F)cc12)N1CCc2ccccc21 |
| InChI | InChI=1S/C25H22FN3O/c26-18-11-12-21-20(16-18)19(25(28-21)22-8-3-4-14-27-22)7-5-10-24(30)29-15-13-17-6-1-2-9-23(17)29/h1-4,6,8-9,11-12,14,16,28H,5,7,10,13,15H2 |
| InChIKey | OVTVESQYSGTXFT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|