C23H20N4O6 — CID 18829328
3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 18829328) has the molecular formula C23H20N4O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 18829328 |
| Molecular Formula | C23H20N4O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-(3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccco1)C1=C(O)C(=O)N(CCCn2ccnc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N4O6/c28-19(8-7-18-6-2-13-33-18)20-21(16-4-1-5-17(14-16)27(31)32)26(23(30)22(20)29)11-3-10-25-12-9-24-15-25/h1-2,4-9,12-15,21,29H,3,10-11H2/b8-7+ |
| InChIKey | IKUJAKJHQUOSRG-BQYQJAHWSA-N |
| XLogP | 3.45 |
| TPSA | 131.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|