C23H20ClN3O4 — CID 6222050
2-(4-chlorophenyl)-3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2H-pyrrol-5-one (PubChem CID 6222050) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-chlorophenyl)-3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6222050 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccco1)C1=C(O)C(=O)N(CCCn2ccnc2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O4/c24-17-6-4-16(5-7-17)21-20(19(28)9-8-18-3-1-14-31-18)22(29)23(30)27(21)12-2-11-26-13-10-25-15-26/h1,3-10,13-15,21,29H,2,11-12H2/b9-8+ |
| InChIKey | PQDPDSUSCMRWGP-CMDGGOBGSA-N |
| XLogP | 4.20 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|