C22H20N4O4 — CID 6225710
3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-pyridin-3-yl-2H-pyrrol-5-one (PubChem CID 6225710) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-pyridin-3-yl-2H-pyrrol-5-one.
| Compound Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-pyridin-3-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6225710 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-imidazol-1-ylpropyl)-2-pyridin-3-yl-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccco1)C1=C(O)C(=O)N(CCCn2ccnc2)C1c1cccnc1 |
| InChI | InChI=1S/C22H20N4O4/c27-18(7-6-17-5-2-13-30-17)19-20(16-4-1-8-23-14-16)26(22(29)21(19)28)11-3-10-25-12-9-24-15-25/h1-2,4-9,12-15,20,28H,3,10-11H2/b7-6+ |
| InChIKey | NIJZRIDPIDYFEY-VOTSOKGWSA-N |
| XLogP | 2.94 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|