C28H34N4O3S2 — CID 18831385
6-[(4-methoxyphenyl)methylamino]-1,4-dimethyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile (PubChem CID 18831385) has the molecular formula C28H34N4O3S2 and a molecular weight of 538.74 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methylamino]-1,4-dimethyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-[(4-methoxyphenyl)methylamino]-1,4-dimethyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831385 |
| Molecular Formula | C28H34N4O3S2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 6-[(4-methoxyphenyl)methylamino]-1,4-dimethyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(C)c2NCc2ccc(OC)cc2)SC1=S |
| InChI | InChI=1S/C28H34N4O3S2/c1-5-6-7-8-9-10-15-32-27(34)24(37-28(32)36)16-22-19(2)23(17-29)26(33)31(3)25(22)30-18-20-11-13-21(35-4)14-12-20/h11-14,16,30H,5-10,15,18H2,1-4H3/b24-16+ |
| InChIKey | VFVUIJLYBJVCRN-LFVJCYFKSA-N |
| XLogP | 5.75 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|