C29H36N4O3S2 — CID 18831120
1-ethyl-6-[(4-methoxyphenyl)methylamino]-4-methyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile (PubChem CID 18831120) has the molecular formula C29H36N4O3S2 and a molecular weight of 552.77 g/mol. Its IUPAC name is 1-ethyl-6-[(4-methoxyphenyl)methylamino]-4-methyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-ethyl-6-[(4-methoxyphenyl)methylamino]-4-methyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831120 |
| Molecular Formula | C29H36N4O3S2 |
| Molecular Weight | 552.77 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 1-ethyl-6-[(4-methoxyphenyl)methylamino]-4-methyl-5-[(E)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CC)c2NCc2ccc(OC)cc2)SC1=S |
| InChI | InChI=1S/C29H36N4O3S2/c1-5-7-8-9-10-11-16-33-28(35)25(38-29(33)37)17-23-20(3)24(18-30)27(34)32(6-2)26(23)31-19-21-12-14-22(36-4)15-13-21/h12-15,17,31H,5-11,16,19H2,1-4H3/b25-17+ |
| InChIKey | BPBDYHGWCDYBAV-KOEQRZSOSA-N |
| XLogP | 6.23 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.77 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|