C27H32N4O3S2 — CID 18831404
5-[(E)-(3-heptyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[(4-methoxyphenyl)methylamino]-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 18831404) has the molecular formula C27H32N4O3S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is 5-[(E)-(3-heptyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[(4-methoxyphenyl)methylamino]-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(E)-(3-heptyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[(4-methoxyphenyl)methylamino]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831404 |
| Molecular Formula | C27H32N4O3S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 5-[(E)-(3-heptyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[(4-methoxyphenyl)methylamino]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(C)c2NCc2ccc(OC)cc2)SC1=S |
| InChI | InChI=1S/C27H32N4O3S2/c1-5-6-7-8-9-14-31-26(33)23(36-27(31)35)15-21-18(2)22(16-28)25(32)30(3)24(21)29-17-19-10-12-20(34-4)13-11-19/h10-13,15,29H,5-9,14,17H2,1-4H3/b23-15+ |
| InChIKey | OJEIEECLLQECAZ-HZHRSRAPSA-N |
| XLogP | 5.36 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|