C26H27FN4O4S2 — CID 18831175
6-[(5E)-5-[[5-cyano-1-ethyl-2-[(4-fluorophenyl)methylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 18831175) has the molecular formula C26H27FN4O4S2 and a molecular weight of 542.66 g/mol. Its IUPAC name is 6-[(5E)-5-[[5-cyano-1-ethyl-2-[(4-fluorophenyl)methylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5E)-5-[[5-cyano-1-ethyl-2-[(4-fluorophenyl)methylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 18831175 |
| Molecular Formula | C26H27FN4O4S2 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 6-[(5E)-5-[[5-cyano-1-ethyl-2-[(4-fluorophenyl)methylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CCn1c(NCc2ccc(F)cc2)c(/C=C2/SC(=S)N(CCCCCC(=O)O)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C26H27FN4O4S2/c1-3-30-23(29-15-17-8-10-18(27)11-9-17)19(16(2)20(14-28)24(30)34)13-21-25(35)31(26(36)37-21)12-6-4-5-7-22(32)33/h8-11,13,29H,3-7,12,15H2,1-2H3,(H,32,33)/b21-13+ |
| InChIKey | JONRTSHKBPVHNL-FYJGNVAPSA-N |
| XLogP | 4.65 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|