C25H25FN4O4S2 — CID 18831970
3-[(5E)-5-[[1-butyl-5-cyano-2-[(4-fluorophenyl)methylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 18831970) has the molecular formula C25H25FN4O4S2 and a molecular weight of 528.63 g/mol. Its IUPAC name is 3-[(5E)-5-[[1-butyl-5-cyano-2-[(4-fluorophenyl)methylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-5-[[1-butyl-5-cyano-2-[(4-fluorophenyl)methylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 18831970 |
| Molecular Formula | C25H25FN4O4S2 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 3-[(5E)-5-[[1-butyl-5-cyano-2-[(4-fluorophenyl)methylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CCCCn1c(NCc2ccc(F)cc2)c(/C=C2/SC(=S)N(CCC(=O)O)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C25H25FN4O4S2/c1-3-4-10-29-22(28-14-16-5-7-17(26)8-6-16)18(15(2)19(13-27)23(29)33)12-20-24(34)30(25(35)36-20)11-9-21(31)32/h5-8,12,28H,3-4,9-11,14H2,1-2H3,(H,31,32)/b20-12+ |
| InChIKey | OOYOUHZHNFBNQF-UDWIEESQSA-N |
| XLogP | 4.26 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|