C28H32N4O6S2 — CID 18831818
3-[(5E)-5-[[1-butyl-5-cyano-2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 18831818) has the molecular formula C28H32N4O6S2 and a molecular weight of 584.72 g/mol. Its IUPAC name is 3-[(5E)-5-[[1-butyl-5-cyano-2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-5-[[1-butyl-5-cyano-2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 18831818 |
| Molecular Formula | C28H32N4O6S2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 3-[(5E)-5-[[1-butyl-5-cyano-2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CCCCn1c(NCCc2ccc(OC)c(OC)c2)c(/C=C2/SC(=S)N(CCC(=O)O)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C28H32N4O6S2/c1-5-6-12-31-25(30-11-9-18-7-8-21(37-3)22(14-18)38-4)19(17(2)20(16-29)26(31)35)15-23-27(36)32(28(39)40-23)13-10-24(33)34/h7-8,14-15,30H,5-6,9-13H2,1-4H3,(H,33,34)/b23-15+ |
| InChIKey | XTUHDVGRKQJWBR-HZHRSRAPSA-N |
| XLogP | 4.18 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|