C28H34N4O2S2 — CID 18830987
1-ethyl-5-[(E)-(3-heptyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile (PubChem CID 18830987) has the molecular formula C28H34N4O2S2 and a molecular weight of 522.74 g/mol. Its IUPAC name is 1-ethyl-5-[(E)-(3-heptyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile.
| Compound Name | 1-ethyl-5-[(E)-(3-heptyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18830987 |
| Molecular Formula | C28H34N4O2S2 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 1-ethyl-5-[(E)-(3-heptyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile |
| SMILES | CCCCCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CC)c2NCCc2ccccc2)SC1=S |
| InChI | InChI=1S/C28H34N4O2S2/c1-4-6-7-8-12-17-32-27(34)24(36-28(32)35)18-22-20(3)23(19-29)26(33)31(5-2)25(22)30-16-15-21-13-10-9-11-14-21/h9-11,13-14,18,30H,4-8,12,15-17H2,1-3H3/b24-18+ |
| InChIKey | GZXUVXJQMRAKGA-HKOYGPOVSA-N |
| XLogP | 5.87 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|