C28H26N4O2S2 — CID 18831052
6-(benzylamino)-1-ethyl-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile (PubChem CID 18831052) has the molecular formula C28H26N4O2S2 and a molecular weight of 514.68 g/mol. Its IUPAC name is 6-(benzylamino)-1-ethyl-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile.
| Compound Name | 6-(benzylamino)-1-ethyl-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831052 |
| Molecular Formula | C28H26N4O2S2 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 6-(benzylamino)-1-ethyl-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]pyridine-3-carbonitrile |
| SMILES | CCn1c(NCc2ccccc2)c(/C=C2/SC(=S)N(CCc3ccccc3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C28H26N4O2S2/c1-3-31-25(30-18-21-12-8-5-9-13-21)22(19(2)23(17-29)26(31)33)16-24-27(34)32(28(35)36-24)15-14-20-10-6-4-7-11-20/h4-13,16,30H,3,14-15,18H2,1-2H3/b24-16+ |
| InChIKey | WRPFZVZFGWSOMF-LFVJCYFKSA-N |
| XLogP | 5.10 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|