C28H34N4O2S2 — CID 18831047
6-(benzylamino)-1-ethyl-5-[(E)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 18831047) has the molecular formula C28H34N4O2S2 and a molecular weight of 522.74 g/mol. Its IUPAC name is 6-(benzylamino)-1-ethyl-5-[(E)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-(benzylamino)-1-ethyl-5-[(E)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831047 |
| Molecular Formula | C28H34N4O2S2 |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 6-(benzylamino)-1-ethyl-5-[(E)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCC(CC)CN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CC)c2NCc2ccccc2)SC1=S |
| InChI | InChI=1S/C28H34N4O2S2/c1-5-8-12-20(6-2)18-32-27(34)24(36-28(32)35)15-22-19(4)23(16-29)26(33)31(7-3)25(22)30-17-21-13-10-9-11-14-21/h9-11,13-15,20,30H,5-8,12,17-18H2,1-4H3/b24-15+ |
| InChIKey | FPWUPXYWHJKSLI-BUVRLJJBSA-N |
| XLogP | 6.08 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|