C31H40N4O4S2 — CID 18831009
6-[2-(3,4-dimethoxyphenyl)ethylamino]-1-ethyl-5-[(E)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 18831009) has the molecular formula C31H40N4O4S2 and a molecular weight of 596.82 g/mol. Its IUPAC name is 6-[2-(3,4-dimethoxyphenyl)ethylamino]-1-ethyl-5-[(E)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-[2-(3,4-dimethoxyphenyl)ethylamino]-1-ethyl-5-[(E)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831009 |
| Molecular Formula | C31H40N4O4S2 |
| Molecular Weight | 596.82 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 6-[2-(3,4-dimethoxyphenyl)ethylamino]-1-ethyl-5-[(E)-[3-(2-ethylhexyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCC(CC)CN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CC)c2NCCc2ccc(OC)c(OC)c2)SC1=S |
| InChI | InChI=1S/C31H40N4O4S2/c1-7-10-11-21(8-2)19-35-30(37)27(41-31(35)40)17-23-20(4)24(18-32)29(36)34(9-3)28(23)33-15-14-22-12-13-25(38-5)26(16-22)39-6/h12-13,16-17,21,33H,7-11,14-15,19H2,1-6H3/b27-17+ |
| InChIKey | GHLOLENHBRREEU-WPWMEQJKSA-N |
| XLogP | 6.14 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.82 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|