C24H26N4O2S2 — CID 18831576
6-(benzylamino)-4-methyl-2-oxo-5-[(E)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propylpyridine-3-carbonitrile (PubChem CID 18831576) has the molecular formula C24H26N4O2S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 6-(benzylamino)-4-methyl-2-oxo-5-[(E)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propylpyridine-3-carbonitrile.
| Compound Name | 6-(benzylamino)-4-methyl-2-oxo-5-[(E)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831576 |
| Molecular Formula | C24H26N4O2S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 6-(benzylamino)-4-methyl-2-oxo-5-[(E)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(NCc2ccccc2)c(/C=C2/SC(=S)N(C(C)C)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C24H26N4O2S2/c1-5-11-27-21(26-14-17-9-7-6-8-10-17)18(16(4)19(13-25)22(27)29)12-20-23(30)28(15(2)3)24(31)32-20/h6-10,12,15,26H,5,11,14H2,1-4H3/b20-12+ |
| InChIKey | ZZCVYJBJJZOHAK-UDWIEESQSA-N |
| XLogP | 4.66 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|