C22H21FN4O2S2 — CID 18831424
6-[(4-fluorophenyl)methylamino]-1,4-dimethyl-2-oxo-5-[(E)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile (PubChem CID 18831424) has the molecular formula C22H21FN4O2S2 and a molecular weight of 456.57 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methylamino]-1,4-dimethyl-2-oxo-5-[(E)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile.
| Compound Name | 6-[(4-fluorophenyl)methylamino]-1,4-dimethyl-2-oxo-5-[(E)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831424 |
| Molecular Formula | C22H21FN4O2S2 |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 6-[(4-fluorophenyl)methylamino]-1,4-dimethyl-2-oxo-5-[(E)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(/C=C2/SC(=S)N(C(C)C)C2=O)c(NCc2ccc(F)cc2)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C22H21FN4O2S2/c1-12(2)27-21(29)18(31-22(27)30)9-16-13(3)17(10-24)20(28)26(4)19(16)25-11-14-5-7-15(23)8-6-14/h5-9,12,25H,11H2,1-4H3/b18-9+ |
| InChIKey | BWCCTFXWCSWVEH-GIJQJNRQSA-N |
| XLogP | 3.93 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|