C23H23FN4O2S2 — CID 18831446
5-[(E)-(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[(4-fluorophenyl)methylamino]-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 18831446) has the molecular formula C23H23FN4O2S2 and a molecular weight of 470.60 g/mol. Its IUPAC name is 5-[(E)-(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[(4-fluorophenyl)methylamino]-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(E)-(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[(4-fluorophenyl)methylamino]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831446 |
| Molecular Formula | C23H23FN4O2S2 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 5-[(E)-(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-[(4-fluorophenyl)methylamino]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCC(C)N1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(C)c2NCc2ccc(F)cc2)SC1=S |
| InChI | InChI=1S/C23H23FN4O2S2/c1-5-13(2)28-22(30)19(32-23(28)31)10-17-14(3)18(11-25)21(29)27(4)20(17)26-12-15-6-8-16(24)9-7-15/h6-10,13,26H,5,12H2,1-4H3/b19-10+ |
| InChIKey | DGFKAXHCIYZIEH-VXLYETTFSA-N |
| XLogP | 4.32 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|