C29H27FN4O2S2 — CID 18831697
6-[(4-fluorophenyl)methylamino]-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-propylpyridine-3-carbonitrile (PubChem CID 18831697) has the molecular formula C29H27FN4O2S2 and a molecular weight of 546.69 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methylamino]-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-propylpyridine-3-carbonitrile.
| Compound Name | 6-[(4-fluorophenyl)methylamino]-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831697 |
| Molecular Formula | C29H27FN4O2S2 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 6-[(4-fluorophenyl)methylamino]-4-methyl-2-oxo-5-[(E)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(NCc2ccc(F)cc2)c(/C=C2/SC(=S)N(CCc3ccccc3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C29H27FN4O2S2/c1-3-14-33-26(32-18-21-9-11-22(30)12-10-21)23(19(2)24(17-31)27(33)35)16-25-28(36)34(29(37)38-25)15-13-20-7-5-4-6-8-20/h4-12,16,32H,3,13-15,18H2,1-2H3/b25-16+ |
| InChIKey | FTDKICIXDIBAPC-PCLIKHOPSA-N |
| XLogP | 5.63 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|