C27H32N4O2S2 — CID 18831497
4-methyl-2-oxo-5-[(E)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2-phenylethylamino)-1-propylpyridine-3-carbonitrile (PubChem CID 18831497) has the molecular formula C27H32N4O2S2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 4-methyl-2-oxo-5-[(E)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2-phenylethylamino)-1-propylpyridine-3-carbonitrile.
| Compound Name | 4-methyl-2-oxo-5-[(E)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2-phenylethylamino)-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831497 |
| Molecular Formula | C27H32N4O2S2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-methyl-2-oxo-5-[(E)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2-phenylethylamino)-1-propylpyridine-3-carbonitrile |
| SMILES | CCCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CCC)c2NCCc2ccccc2)SC1=S |
| InChI | InChI=1S/C27H32N4O2S2/c1-4-6-10-16-31-26(33)23(35-27(31)34)17-21-19(3)22(18-28)25(32)30(15-5-2)24(21)29-14-13-20-11-8-7-9-12-20/h7-9,11-12,17,29H,4-6,10,13-16H2,1-3H3/b23-17+ |
| InChIKey | WPFXBVPJRBCGFF-HAVVHWLPSA-N |
| XLogP | 5.48 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|