C22H22N4O2S2 — CID 18830962
1-ethyl-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile (PubChem CID 18830962) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-ethyl-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile.
| Compound Name | 1-ethyl-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18830962 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1-ethyl-4-methyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile |
| SMILES | CCn1c(NCCc2ccccc2)c(/C=C2/SC(=S)N(C)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C22H22N4O2S2/c1-4-26-19(24-11-10-15-8-6-5-7-9-15)16(14(2)17(13-23)20(26)27)12-18-21(28)25(3)22(29)30-18/h5-9,12,24H,4,10-11H2,1-3H3/b18-12+ |
| InChIKey | QBIJHLQNHBTSCD-LDADJPATSA-N |
| XLogP | 3.53 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|