C21H20N4O2S2 — CID 18831228
1,4-dimethyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile (PubChem CID 18831228) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 1,4-dimethyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile.
| Compound Name | 1,4-dimethyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831228 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 1,4-dimethyl-5-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile |
| SMILES | Cc1c(/C=C2/SC(=S)N(C)C2=O)c(NCCc2ccccc2)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C21H20N4O2S2/c1-13-15(11-17-20(27)25(3)21(28)29-17)18(24(2)19(26)16(13)12-22)23-10-9-14-7-5-4-6-8-14/h4-8,11,23H,9-10H2,1-3H3/b17-11+ |
| InChIKey | NMSXOISOOLJVNX-GZTJUZNOSA-N |
| XLogP | 3.05 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|