C28H24N4O4S2 — CID 18831260
5-[(E)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile (PubChem CID 18831260) has the molecular formula C28H24N4O4S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is 5-[(E)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile.
| Compound Name | 5-[(E)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831260 |
| Molecular Formula | C28H24N4O4S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 5-[(E)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(2-phenylethylamino)pyridine-3-carbonitrile |
| SMILES | Cc1c(/C=C2/SC(=S)N(Cc3ccc4c(c3)OCO4)C2=O)c(NCCc2ccccc2)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C28H24N4O4S2/c1-17-20(25(31(2)26(33)21(17)14-29)30-11-10-18-6-4-3-5-7-18)13-24-27(34)32(28(37)38-24)15-19-8-9-22-23(12-19)36-16-35-22/h3-9,12-13,30H,10-11,15-16H2,1-2H3/b24-13+ |
| InChIKey | SOIPQRMQTDEOLT-ZMOGYAJESA-N |
| XLogP | 4.35 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|