C30H27N5O4S2 — CID 6315506
5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile (PubChem CID 6315506) has the molecular formula C30H27N5O4S2 and a molecular weight of 585.71 g/mol. Its IUPAC name is 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6315506 |
| Molecular Formula | C30H27N5O4S2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
| SMILES | Cc1c(/C=C2\SC(=S)N(Cc3ccc4c(c3)OCO4)C2=O)c(N2CCN(c3ccccc3)CC2)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C30H27N5O4S2/c1-19-22(15-26-29(37)35(30(40)41-26)17-20-8-9-24-25(14-20)39-18-38-24)27(32(2)28(36)23(19)16-31)34-12-10-33(11-13-34)21-6-4-3-5-7-21/h3-9,14-15H,10-13,17-18H2,1-2H3/b26-15- |
| InChIKey | VLFOUFZZCYFSAG-YSMPRRRNSA-N |
| XLogP | 4.02 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|