C34H35N5O4S2 — CID 6317699
5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperazin-1-yl)-1-butyl-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 6317699) has the molecular formula C34H35N5O4S2 and a molecular weight of 641.82 g/mol. Its IUPAC name is 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperazin-1-yl)-1-butyl-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperazin-1-yl)-1-butyl-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6317699 |
| Molecular Formula | C34H35N5O4S2 |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperazin-1-yl)-1-butyl-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCN(Cc3ccccc3)CC2)c(/C=C2\SC(=S)N(Cc3ccc4c(c3)OCO4)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C34H35N5O4S2/c1-3-4-12-38-31(37-15-13-36(14-16-37)20-24-8-6-5-7-9-24)26(23(2)27(19-35)32(38)40)18-30-33(41)39(34(44)45-30)21-25-10-11-28-29(17-25)43-22-42-28/h5-11,17-18H,3-4,12-16,20-22H2,1-2H3/b30-18- |
| InChIKey | VKTDJBMOLYOULC-YKQZZPSBSA-N |
| XLogP | 5.28 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|