C31H33N5O3S2 — CID 5266653
6-(4-benzylpiperazin-1-yl)-1-butyl-5-[[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 5266653) has the molecular formula C31H33N5O3S2 and a molecular weight of 587.77 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-1-butyl-5-[[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-1-butyl-5-[[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5266653 |
| Molecular Formula | C31H33N5O3S2 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-1-butyl-5-[[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCN(Cc3ccccc3)CC2)c(C=C2SC(=S)N(Cc3ccco3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C31H33N5O3S2/c1-3-4-12-35-28(34-15-13-33(14-16-34)20-23-9-6-5-7-10-23)25(22(2)26(19-32)29(35)37)18-27-30(38)36(31(40)41-27)21-24-11-8-17-39-24/h5-11,17-18H,3-4,12-16,20-21H2,1-2H3 |
| InChIKey | WDVDSUMYVMBYIN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|