C29H29N5O3S2 — CID 5266009
5-[[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)-1-propylpyridine-3-carbonitrile (PubChem CID 5266009) has the molecular formula C29H29N5O3S2 and a molecular weight of 559.72 g/mol. Its IUPAC name is 5-[[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)-1-propylpyridine-3-carbonitrile.
| Compound Name | 5-[[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5266009 |
| Molecular Formula | C29H29N5O3S2 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 5-[[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(N2CCN(c3ccccc3)CC2)c(C=C2SC(=S)N(Cc3ccco3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C29H29N5O3S2/c1-3-11-33-26(32-14-12-31(13-15-32)21-8-5-4-6-9-21)23(20(2)24(18-30)27(33)35)17-25-28(36)34(29(38)39-25)19-22-10-7-16-37-22/h4-10,16-17H,3,11-15,19H2,1-2H3 |
| InChIKey | VSNRILAXJUHTBK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|