C30H31N5O3S2 — CID 6317968
1-butyl-5-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile (PubChem CID 6317968) has the molecular formula C30H31N5O3S2 and a molecular weight of 573.74 g/mol. Its IUPAC name is 1-butyl-5-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6317968 |
| Molecular Formula | C30H31N5O3S2 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 1-butyl-5-[(Z)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCN(c3ccccc3)CC2)c(/C=C2\SC(=S)N(Cc3ccco3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C30H31N5O3S2/c1-3-4-12-34-27(33-15-13-32(14-16-33)22-9-6-5-7-10-22)24(21(2)25(19-31)28(34)36)18-26-29(37)35(30(39)40-26)20-23-11-8-17-38-23/h5-11,17-18H,3-4,12-16,20H2,1-2H3/b26-18- |
| InChIKey | KQBSSPXCGDFISY-ITYLOYPMSA-N |
| XLogP | 5.15 |
| TPSA | 85.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|