C25H29N5O3S2 — CID 23430382
1-butyl-5-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile (PubChem CID 23430382) has the molecular formula C25H29N5O3S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is 1-butyl-5-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23430382 |
| Molecular Formula | C25H29N5O3S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 1-butyl-5-[(E)-[3-(furan-2-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCN(C)CC2)c(/C=C2/SC(=S)N(Cc3ccco3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C25H29N5O3S2/c1-4-5-8-29-22(28-11-9-27(3)10-12-28)19(17(2)20(15-26)23(29)31)14-21-24(32)30(25(34)35-21)16-18-7-6-13-33-18/h6-7,13-14H,4-5,8-12,16H2,1-3H3/b21-14+ |
| InChIKey | ROXIOBYJVBLCKH-KGENOOAVSA-N |
| XLogP | 3.57 |
| TPSA | 85.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|