C32H31N5O4S2 — CID 23429204
5-[(E)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperazin-1-yl)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 23429204) has the molecular formula C32H31N5O4S2 and a molecular weight of 613.77 g/mol. Its IUPAC name is 5-[(E)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperazin-1-yl)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(E)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperazin-1-yl)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23429204 |
| Molecular Formula | C32H31N5O4S2 |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 5-[(E)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperazin-1-yl)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCn1c(N2CCN(Cc3ccccc3)CC2)c(/C=C2/SC(=S)N(Cc3ccc4c(c3)OCO4)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C32H31N5O4S2/c1-3-36-29(35-13-11-34(12-14-35)18-22-7-5-4-6-8-22)24(21(2)25(17-33)30(36)38)16-28-31(39)37(32(42)43-28)19-23-9-10-26-27(15-23)41-20-40-26/h4-10,15-16H,3,11-14,18-20H2,1-2H3/b28-16+ |
| InChIKey | GPSTUEWOWJBMJD-LQKURTRISA-N |
| XLogP | 4.50 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|