C33H32N4O4S2 — CID 6315807
5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperidin-1-yl)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 6315807) has the molecular formula C33H32N4O4S2 and a molecular weight of 612.78 g/mol. Its IUPAC name is 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperidin-1-yl)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperidin-1-yl)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6315807 |
| Molecular Formula | C33H32N4O4S2 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 5-[(Z)-[3-(1,3-benzodioxol-5-ylmethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-(4-benzylpiperidin-1-yl)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCn1c(N2CCC(Cc3ccccc3)CC2)c(/C=C2\SC(=S)N(Cc3ccc4c(c3)OCO4)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C33H32N4O4S2/c1-3-36-30(35-13-11-23(12-14-35)15-22-7-5-4-6-8-22)25(21(2)26(18-34)31(36)38)17-29-32(39)37(33(42)43-29)19-24-9-10-27-28(16-24)41-20-40-27/h4-10,16-17,23H,3,11-15,19-20H2,1-2H3/b29-17- |
| InChIKey | XJRCAZUXTIEVTK-RHANQZHGSA-N |
| XLogP | 5.64 |
| TPSA | 87.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|