C23H24N4O2S2 — CID 18831230
1,4-dimethyl-2-oxo-5-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2-phenylethylamino)pyridine-3-carbonitrile (PubChem CID 18831230) has the molecular formula C23H24N4O2S2 and a molecular weight of 452.61 g/mol. Its IUPAC name is 1,4-dimethyl-2-oxo-5-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2-phenylethylamino)pyridine-3-carbonitrile.
| Compound Name | 1,4-dimethyl-2-oxo-5-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2-phenylethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831230 |
| Molecular Formula | C23H24N4O2S2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 1,4-dimethyl-2-oxo-5-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(2-phenylethylamino)pyridine-3-carbonitrile |
| SMILES | CCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(C)c2NCCc2ccccc2)SC1=S |
| InChI | InChI=1S/C23H24N4O2S2/c1-4-12-27-22(29)19(31-23(27)30)13-17-15(2)18(14-24)21(28)26(3)20(17)25-11-10-16-8-6-5-7-9-16/h5-9,13,25H,4,10-12H2,1-3H3/b19-13+ |
| InChIKey | VQHHUCYATDOONH-CPNJWEJPSA-N |
| XLogP | 3.83 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|