C25H27FN4O3S2 — CID 18831960
1-butyl-6-[(4-fluorophenyl)methylamino]-5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 18831960) has the molecular formula C25H27FN4O3S2 and a molecular weight of 514.65 g/mol. Its IUPAC name is 1-butyl-6-[(4-fluorophenyl)methylamino]-5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-6-[(4-fluorophenyl)methylamino]-5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18831960 |
| Molecular Formula | C25H27FN4O3S2 |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 1-butyl-6-[(4-fluorophenyl)methylamino]-5-[(E)-[3-(2-methoxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(NCc2ccc(F)cc2)c(/C=C2/SC(=S)N(CCOC)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C25H27FN4O3S2/c1-4-5-10-29-22(28-15-17-6-8-18(26)9-7-17)19(16(2)20(14-27)23(29)31)13-21-24(32)30(11-12-33-3)25(34)35-21/h6-9,13,28H,4-5,10-12,15H2,1-3H3/b21-13+ |
| InChIKey | HPGRVHATVRMBKZ-FYJGNVAPSA-N |
| XLogP | 4.43 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|