C21H22N4O3S2 — CID 23473241
1-ethyl-6-(furan-2-ylmethylamino)-4-methyl-2-oxo-5-[(Z)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile (PubChem CID 23473241) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 1-ethyl-6-(furan-2-ylmethylamino)-4-methyl-2-oxo-5-[(Z)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile.
| Compound Name | 1-ethyl-6-(furan-2-ylmethylamino)-4-methyl-2-oxo-5-[(Z)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23473241 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 1-ethyl-6-(furan-2-ylmethylamino)-4-methyl-2-oxo-5-[(Z)-(4-oxo-3-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
| SMILES | CCn1c(NCc2ccco2)c(/C=C2\SC(=S)N(C(C)C)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C21H22N4O3S2/c1-5-24-18(23-11-14-7-6-8-28-14)15(13(4)16(10-22)19(24)26)9-17-20(27)25(12(2)3)21(29)30-17/h6-9,12,23H,5,11H2,1-4H3/b17-9- |
| InChIKey | MPGKGQZICQYUJF-MFOYZWKCSA-N |
| XLogP | 3.86 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|