C19H18N4O3S2 — CID 23473205
5-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethylamino)-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 23473205) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 5-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethylamino)-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethylamino)-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23473205 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 5-[(Z)-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethylamino)-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCN1C(=O)/C(=C/c2c(C)c(C#N)c(=O)n(C)c2NCc2ccco2)SC1=S |
| InChI | InChI=1S/C19H18N4O3S2/c1-4-23-18(25)15(28-19(23)27)8-13-11(2)14(9-20)17(24)22(3)16(13)21-10-12-6-5-7-26-12/h5-8,21H,4,10H2,1-3H3/b15-8- |
| InChIKey | QWFUBOIWQDIDJT-NVNXTCNLSA-N |
| XLogP | 2.99 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|