C31H38N4O4S2 — CID 5267106
6-(azepan-1-yl)-1-butyl-5-[[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 5267106) has the molecular formula C31H38N4O4S2 and a molecular weight of 594.80 g/mol. Its IUPAC name is 6-(azepan-1-yl)-1-butyl-5-[[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-(azepan-1-yl)-1-butyl-5-[[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5267106 |
| Molecular Formula | C31H38N4O4S2 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | 6-(azepan-1-yl)-1-butyl-5-[[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CCCCCC2)c(C=C2SC(=S)N(CCc3ccc(OC)c(OC)c3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C31H38N4O4S2/c1-5-6-16-34-28(33-14-9-7-8-10-15-33)23(21(2)24(20-32)29(34)36)19-27-30(37)35(31(40)41-27)17-13-22-11-12-25(38-3)26(18-22)39-4/h11-12,18-19H,5-10,13-17H2,1-4H3 |
| InChIKey | LSROOFKBWILYLV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 87.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|